C19H21N3O6S — CID 2786026
(6-ethyl-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate (PubChem CID 2786026) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is (6-ethyl-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate.
| Compound Name | (6-ethyl-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 2786026 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (6-ethyl-1,3,8-trimethyl-2,4,7-trioxopyrido[2,3-d]pyrimidin-5-yl) 4-methylbenzenesulfonate |
| SMILES | CCc1c(OS(=O)(=O)c2ccc(C)cc2)c2c(=O)n(C)c(=O)n(C)c2n(C)c1=O |
| InChI | InChI=1S/C19H21N3O6S/c1-6-13-15(28-29(26,27)12-9-7-11(2)8-10-12)14-16(20(3)17(13)23)21(4)19(25)22(5)18(14)24/h7-10H,6H2,1-5H3 |
| InChIKey | GJEGCSKUOKESGT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 109.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|