C26H27F3O8S2 — CID 132542290
[(1R,8S)-4,5-diethyl-11,11-dimethyl-6-(trifluoromethylsulfonyloxy)-10,12-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6,9(13)-tetraen-3-yl] 4-methylbenzenesulfonate (PubChem CID 132542290) has the molecular formula C26H27F3O8S2 and a molecular weight of 588.62 g/mol. Its IUPAC name is [(1R,8S)-4,5-diethyl-11,11-dimethyl-6-(trifluoromethylsulfonyloxy)-10,12-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6,9(13)-tetraen-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R,8S)-4,5-diethyl-11,11-dimethyl-6-(trifluoromethylsulfonyloxy)-10,12-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6,9(13)-tetraen-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 132542290 |
| Molecular Formula | C26H27F3O8S2 |
| Molecular Weight | 588.62 g/mol |
| Exact Mass | 588.11 |
| IUPAC Name | [(1R,8S)-4,5-diethyl-11,11-dimethyl-6-(trifluoromethylsulfonyloxy)-10,12-dioxatetracyclo[6.5.1.02,7.09,13]tetradeca-2,4,6,9(13)-tetraen-3-yl] 4-methylbenzenesulfonate |
| SMILES | CCc1c(CC)c(OS(=O)(=O)c2ccc(C)cc2)c2c(c1OS(=O)(=O)C(F)(F)F)[C@@H]1C[C@H]2C2=C1OC(C)(C)O2 |
| InChI | InChI=1S/C26H27F3O8S2/c1-6-15-16(7-2)22(37-39(32,33)26(27,28)29)20-18-12-17(23-24(18)35-25(4,5)34-23)19(20)21(15)36-38(30,31)14-10-8-13(3)9-11-14/h8-11,17-18H,6-7,12H2,1-5H3/t17-,18+/m1/s1 |
| InChIKey | VEWAQKWSTUVXDB-MSOLQXFVSA-N |
| XLogP | 5.69 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|