C26H27F3O10S2 — CID 86748921
methyl (E)-3,4-dimethyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoate (PubChem CID 86748921) has the molecular formula C26H27F3O10S2 and a molecular weight of 620.62 g/mol. Its IUPAC name is methyl (E)-3,4-dimethyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoate.
| Compound Name | methyl (E)-3,4-dimethyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoate |
|---|---|
| PubChem CID | 86748921 |
| Molecular Formula | C26H27F3O10S2 |
| Molecular Weight | 620.62 g/mol |
| Exact Mass | 620.10 |
| IUPAC Name | methyl (E)-3,4-dimethyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]hex-4-enoate |
| SMILES | COC(=O)CC(C)/C(C)=C/Cc1c(OS(=O)(=O)C(F)(F)F)c(C)c2c(c1OS(=O)(=O)c1ccc(C)cc1)C(=O)OC2 |
| InChI | InChI=1S/C26H27F3O10S2/c1-14-6-9-18(10-7-14)40(32,33)38-24-19(11-8-15(2)16(3)12-21(30)36-5)23(39-41(34,35)26(27,28)29)17(4)20-13-37-25(31)22(20)24/h6-10,16H,11-13H2,1-5H3/b15-8+ |
| InChIKey | BOJCMZCSRHUKLW-OVCLIPMQSA-N |
| XLogP | 4.66 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.62 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|