C24H26O7S — CID 22858954
[5-[(2E)-4-hydroxy-3-methylhexa-2,5-dienyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl] 4-methylbenzenesulfonate (PubChem CID 22858954) has the molecular formula C24H26O7S and a molecular weight of 458.53 g/mol. Its IUPAC name is [5-[(2E)-4-hydroxy-3-methylhexa-2,5-dienyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl] 4-methylbenzenesulfonate.
| Compound Name | [5-[(2E)-4-hydroxy-3-methylhexa-2,5-dienyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 22858954 |
| Molecular Formula | C24H26O7S |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | [5-[(2E)-4-hydroxy-3-methylhexa-2,5-dienyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC(O)/C(C)=C/Cc1c(OC)c(C)c2c(c1OS(=O)(=O)c1ccc(C)cc1)C(=O)OC2 |
| InChI | InChI=1S/C24H26O7S/c1-6-20(25)15(3)9-12-18-22(29-5)16(4)19-13-30-24(26)21(19)23(18)31-32(27,28)17-10-7-14(2)8-11-17/h6-11,20,25H,1,12-13H2,2-5H3/b15-9+ |
| InChIKey | SPLGOZMLBHPRAE-OQLLNIDSSA-N |
| XLogP | 3.79 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|