C26H28O8S — CID 18987779
2-[3-[[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]methyl]-2-methylcyclopent-2-en-1-yl]acetic acid (PubChem CID 18987779) has the molecular formula C26H28O8S and a molecular weight of 500.57 g/mol. Its IUPAC name is 2-[3-[[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]methyl]-2-methylcyclopent-2-en-1-yl]acetic acid.
| Compound Name | 2-[3-[[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]methyl]-2-methylcyclopent-2-en-1-yl]acetic acid |
|---|---|
| PubChem CID | 18987779 |
| Molecular Formula | C26H28O8S |
| Molecular Weight | 500.57 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 2-[3-[[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]methyl]-2-methylcyclopent-2-en-1-yl]acetic acid |
| SMILES | COc1c(C)c2c(c(OS(=O)(=O)c3ccc(C)cc3)c1CC1=C(C)C(CC(=O)O)CC1)C(=O)OC2 |
| InChI | InChI=1S/C26H28O8S/c1-14-5-9-19(10-6-14)35(30,31)34-25-20(11-17-7-8-18(15(17)2)12-22(27)28)24(32-4)16(3)21-13-33-26(29)23(21)25/h5-6,9-10,18H,7-8,11-13H2,1-4H3,(H,27,28) |
| InChIKey | VCEHJLWUNWHVMT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|