C27H30O8S — CID 11548039
methyl 2-[(2E)-2-[2-[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate (PubChem CID 11548039) has the molecular formula C27H30O8S and a molecular weight of 514.60 g/mol. Its IUPAC name is methyl 2-[(2E)-2-[2-[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate.
| Compound Name | methyl 2-[(2E)-2-[2-[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate |
|---|---|
| PubChem CID | 11548039 |
| Molecular Formula | C27H30O8S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 2-[(2E)-2-[2-[6-methoxy-7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-1H-2-benzofuran-5-yl]ethylidene]cyclopentyl]acetate |
| SMILES | COC(=O)CC1CCC/C1=C\Cc1c(OC)c(C)c2c(c1OS(=O)(=O)c1ccc(C)cc1)C(=O)OC2 |
| InChI | InChI=1S/C27H30O8S/c1-16-8-11-20(12-9-16)36(30,31)35-26-21(13-10-18-6-5-7-19(18)14-23(28)32-3)25(33-4)17(2)22-15-34-27(29)24(22)26/h8-12,19H,5-7,13-15H2,1-4H3/b18-10+ |
| InChIKey | DLDGJQYVXVRXAY-VCHYOVAHSA-N |
| XLogP | 4.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|