C30H30O7S — CID 10530370
methyl (E)-4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-phenyl-1H-2-benzofuran-5-yl]hex-4-enoate (PubChem CID 10530370) has the molecular formula C30H30O7S and a molecular weight of 534.63 g/mol. Its IUPAC name is methyl (E)-4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-phenyl-1H-2-benzofuran-5-yl]hex-4-enoate.
| Compound Name | methyl (E)-4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-phenyl-1H-2-benzofuran-5-yl]hex-4-enoate |
|---|---|
| PubChem CID | 10530370 |
| Molecular Formula | C30H30O7S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.17 |
| IUPAC Name | methyl (E)-4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-phenyl-1H-2-benzofuran-5-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C(C)=C/Cc1c(OS(=O)(=O)c2ccc(C)cc2)c2c(c(C)c1-c1ccccc1)COC2=O |
| InChI | InChI=1S/C30H30O7S/c1-19-10-14-23(15-11-19)38(33,34)37-29-24(16-12-20(2)13-17-26(31)35-4)27(22-8-6-5-7-9-22)21(3)25-18-36-30(32)28(25)29/h5-12,14-15H,13,16-18H2,1-4H3/b20-12+ |
| InChIKey | KOBTZKRPHMCRMY-UDWIEESQSA-N |
| XLogP | 5.85 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|