C25H23F3O7S — CID 54246739
4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoic acid (PubChem CID 54246739) has the molecular formula C25H23F3O7S and a molecular weight of 524.51 g/mol. Its IUPAC name is 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoic acid.
| Compound Name | 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoic acid |
|---|---|
| PubChem CID | 54246739 |
| Molecular Formula | C25H23F3O7S |
| Molecular Weight | 524.51 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 4-methyl-6-[7-methyl-4-(4-methylphenyl)sulfonyloxy-3-oxo-6-(1,2,2-trifluoroethenyl)-1H-2-benzofuran-5-yl]hex-4-enoic acid |
| SMILES | CC(=CCc1c(OS(=O)(=O)c2ccc(C)cc2)c2c(c(C)c1C(F)=C(F)F)COC2=O)CCC(=O)O |
| InChI | InChI=1S/C25H23F3O7S/c1-13-4-8-16(9-5-13)36(32,33)35-23-17(10-6-14(2)7-11-19(29)30)20(22(26)24(27)28)15(3)18-12-34-25(31)21(18)23/h4-6,8-9H,7,10-12H2,1-3H3,(H,29,30) |
| InChIKey | QTUGTKICHFYWKR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.51 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|