C19H20F3O7S- — CID 74002151
6-[6-ethyl-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 74002151) has the molecular formula C19H20F3O7S- and a molecular weight of 449.42 g/mol. Its IUPAC name is 6-[6-ethyl-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 6-[6-ethyl-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 74002151 |
| Molecular Formula | C19H20F3O7S- |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 6-[6-ethyl-7-methyl-3-oxo-4-(trifluoromethylsulfonyloxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCc1c(C)c2c(c(OS(=O)(=O)C(F)(F)F)c1CC=C(C)CCC(=O)[O-])C(=O)OC2 |
| InChI | InChI=1S/C19H21F3O7S/c1-4-12-11(3)14-9-28-18(25)16(14)17(29-30(26,27)19(20,21)22)13(12)7-5-10(2)6-8-15(23)24/h5H,4,6-9H2,1-3H3,(H,23,24)/p-1 |
| InChIKey | HZISPSIUDZOSSC-UHFFFAOYSA-M |
| XLogP | 2.48 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|