C34H38O12Zn — CID 11411441
zinc bis((E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate) (PubChem CID 11411441) has the molecular formula C34H38O12Zn and a molecular weight of 704.06 g/mol. Its IUPAC name is zinc bis((E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate).
| Compound Name | zinc bis((E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate) |
|---|---|
| PubChem CID | 11411441 |
| Molecular Formula | C34H38O12Zn |
| Molecular Weight | 704.06 g/mol |
| Exact Mass | 702.17 |
| IUPAC Name | zinc bis((E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate) |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CCC(=O)[O-])C(=O)OC2.COc1c(C)c2c(c(O)c1C/C=C(\C)CCC(=O)[O-])C(=O)OC2.[Zn+2] |
| InChI | InChI=1S/2C17H20O6.Zn/c2*1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3;/h2*4,20H,5-8H2,1-3H3,(H,18,19);/q;;+2/p-2/b2*9-4+; |
| InChIKey | FDEDBVRHGIZLNG-PDBBLTOASA-L |
| XLogP | 2.79 |
| TPSA | 191.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.06 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|