C15H17IO4 — CID 142962688
7-hydroxy-6-[(E)-4-iodo-3-methylbut-2-enyl]-5-methoxy-4-methyl-3H-2-benzofuran-1-one (PubChem CID 142962688) has the molecular formula C15H17IO4 and a molecular weight of 388.20 g/mol. Its IUPAC name is 7-hydroxy-6-[(E)-4-iodo-3-methylbut-2-enyl]-5-methoxy-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 7-hydroxy-6-[(E)-4-iodo-3-methylbut-2-enyl]-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 142962688 |
| Molecular Formula | C15H17IO4 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.02 |
| IUPAC Name | 7-hydroxy-6-[(E)-4-iodo-3-methylbut-2-enyl]-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CI)C(=O)OC2 |
| InChI | InChI=1S/C15H17IO4/c1-8(6-16)4-5-10-13(17)12-11(7-20-15(12)18)9(2)14(10)19-3/h4,17H,5-7H2,1-3H3/b8-4+ |
| InChIKey | XVBSOZAZTLVBIZ-XBXARRHUSA-N |
| XLogP | 3.30 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|