C15H18O7P+ — CID 72563973
hydroxy-[4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enoxy]-oxophosphanium (PubChem CID 72563973) has the molecular formula C15H18O7P+ and a molecular weight of 341.28 g/mol. Its IUPAC name is hydroxy-[4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enoxy]-oxophosphanium.
| Compound Name | hydroxy-[4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enoxy]-oxophosphanium |
|---|---|
| PubChem CID | 72563973 |
| Molecular Formula | C15H18O7P+ |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | hydroxy-[4-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-2-methylbut-2-enoxy]-oxophosphanium |
| SMILES | COc1c(C)c2c(c(O)c1CC=C(C)CO[P+](=O)O)C(=O)OC2 |
| InChI | InChI=1S/C15H17O7P/c1-8(6-22-23(18)19)4-5-10-13(16)12-11(7-21-15(12)17)9(2)14(10)20-3/h4H,5-7H2,1-3H3,(H-,16,17,18,19)/p+1 |
| InChIKey | KISQJBBTEKPKEP-UHFFFAOYSA-O |
| XLogP | 2.53 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|