C22H25O6P — CID 142962341
7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-4-(phenoxyphosphanylmethoxy)but-2-enyl]-3H-2-benzofuran-1-one (PubChem CID 142962341) has the molecular formula C22H25O6P and a molecular weight of 416.41 g/mol. Its IUPAC name is 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-4-(phenoxyphosphanylmethoxy)but-2-enyl]-3H-2-benzofuran-1-one.
| Compound Name | 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-4-(phenoxyphosphanylmethoxy)but-2-enyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 142962341 |
| Molecular Formula | C22H25O6P |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-4-(phenoxyphosphanylmethoxy)but-2-enyl]-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)COCPOc1ccccc1)C(=O)OC2 |
| InChI | InChI=1S/C22H25O6P/c1-14(11-26-13-29-28-16-7-5-4-6-8-16)9-10-17-20(23)19-18(12-27-22(19)24)15(2)21(17)25-3/h4-9,23,29H,10-13H2,1-3H3/b14-9+ |
| InChIKey | OXMWGUTUHKGLIU-NTEUORMPSA-N |
| XLogP | 4.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|