C17H23O5P — CID 59794479
6-[(E)-4-dimethylphosphoryl-3-methylbut-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one (PubChem CID 59794479) has the molecular formula C17H23O5P and a molecular weight of 338.34 g/mol. Its IUPAC name is 6-[(E)-4-dimethylphosphoryl-3-methylbut-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 6-[(E)-4-dimethylphosphoryl-3-methylbut-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 59794479 |
| Molecular Formula | C17H23O5P |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 6-[(E)-4-dimethylphosphoryl-3-methylbut-2-enyl]-7-hydroxy-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CP(C)(C)=O)C(=O)OC2 |
| InChI | InChI=1S/C17H23O5P/c1-10(9-23(4,5)20)6-7-12-15(18)14-13(8-22-17(14)19)11(2)16(12)21-3/h6,18H,7-9H2,1-5H3/b10-6+ |
| InChIKey | OSVZFEWLXFRWNU-UXBLZVDNSA-N |
| XLogP | 3.49 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|