C18H22O5 — CID 58607186
7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-6-oxohept-2-enyl]-3H-2-benzofuran-1-one (PubChem CID 58607186) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-6-oxohept-2-enyl]-3H-2-benzofuran-1-one.
| Compound Name | 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-6-oxohept-2-enyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 58607186 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 7-hydroxy-5-methoxy-4-methyl-6-[(E)-3-methyl-6-oxohept-2-enyl]-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CCC(C)=O)C(=O)OC2 |
| InChI | InChI=1S/C18H22O5/c1-10(5-7-11(2)19)6-8-13-16(20)15-14(9-23-18(15)21)12(3)17(13)22-4/h6,20H,5,7-9H2,1-4H3/b10-6+ |
| InChIKey | WCIGKKPFYHSAEH-UXBLZVDNSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|