C17H21O6P — CID 162423388
phosphanyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (PubChem CID 162423388) has the molecular formula C17H21O6P and a molecular weight of 352.32 g/mol. Its IUPAC name is phosphanyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate.
| Compound Name | phosphanyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 162423388 |
| Molecular Formula | C17H21O6P |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | phosphanyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CCC(=O)OP)C(=O)OC2 |
| InChI | InChI=1S/C17H21O6P/c1-9(5-7-13(18)23-24)4-6-11-15(19)14-12(8-22-17(14)20)10(2)16(11)21-3/h4,19H,5-8,24H2,1-3H3/b9-4+ |
| InChIKey | PEJBZEZHCIPWKC-RUDMXATFSA-N |
| XLogP | 2.98 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|