C23H32NO8+ — CID 163337423
2-(4-hydroxymorpholin-4-ium-4-yl)ethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (PubChem CID 163337423) has the molecular formula C23H32NO8+ and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-(4-hydroxymorpholin-4-ium-4-yl)ethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate.
| Compound Name | 2-(4-hydroxymorpholin-4-ium-4-yl)ethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 163337423 |
| Molecular Formula | C23H32NO8+ |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | 2-(4-hydroxymorpholin-4-ium-4-yl)ethyl (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(O)c1C/C=C(\C)CCC(=O)OCC[N+]1(O)CCOCC1)C(=O)OC2 |
| InChI | InChI=1S/C23H31NO8/c1-15(5-7-19(25)31-13-10-24(28)8-11-30-12-9-24)4-6-17-21(26)20-18(14-32-23(20)27)16(2)22(17)29-3/h4,28H,5-14H2,1-3H3/p+1/b15-4+ |
| InChIKey | UZOLXAXASMWBQY-SYZQJQIISA-O |
| XLogP | 2.43 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|