C22H31NO5 — CID 54020933
propyl 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 54020933) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is propyl 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | propyl 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54020933 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | propyl 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCCOC(=O)CCC(C)=CCc1c(NCC)c2c(c(C)c1OC)COC2=O |
| InChI | InChI=1S/C22H31NO5/c1-6-12-27-18(24)11-9-14(3)8-10-16-20(23-7-2)19-17(13-28-22(19)25)15(4)21(16)26-5/h8,23H,6-7,9-13H2,1-5H3 |
| InChIKey | KYWHGNHRLAMCQO-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|