C27H44O6Si2 — CID 142962335
2-trimethylsilylethyl (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 142962335) has the molecular formula C27H44O6Si2 and a molecular weight of 520.82 g/mol. Its IUPAC name is 2-trimethylsilylethyl (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 2-trimethylsilylethyl (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 142962335 |
| Molecular Formula | C27H44O6Si2 |
| Molecular Weight | 520.82 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | 2-trimethylsilylethyl (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CCC(=O)OCC[Si](C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C27H44O6Si2/c1-19(11-13-23(28)31-14-16-34(4,5)6)10-12-21-25(30-3)20(2)22-18-33-27(29)24(22)26(21)32-15-17-35(7,8)9/h10H,11-18H2,1-9H3/b19-10+ |
| InChIKey | XYQZQPGBRLAWCU-VXLYETTFSA-N |
| XLogP | 6.54 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.82 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|