C22H31NO5 — CID 54572295
3-methylbutyl 6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate (PubChem CID 54572295) has the molecular formula C22H31NO5 and a molecular weight of 389.49 g/mol. Its IUPAC name is 3-methylbutyl 6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate.
| Compound Name | 3-methylbutyl 6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54572295 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 3-methylbutyl 6-(4-amino-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(N)c1CC=C(C)CCC(=O)OCCC(C)C)C(=O)OC2 |
| InChI | InChI=1S/C22H31NO5/c1-13(2)10-11-27-18(24)9-7-14(3)6-8-16-20(23)19-17(12-28-22(19)25)15(4)21(16)26-5/h6,13H,7-12,23H2,1-5H3 |
| InChIKey | ZYEAMOOAFITKEY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|