C28H38O8 — CID 142611288
[6-methoxy-7-methyl-5-[(E)-3-methyl-6-oxohept-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 5-butanoyloxy-2-methylpentanoate (PubChem CID 142611288) has the molecular formula C28H38O8 and a molecular weight of 502.60 g/mol. Its IUPAC name is [6-methoxy-7-methyl-5-[(E)-3-methyl-6-oxohept-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 5-butanoyloxy-2-methylpentanoate.
| Compound Name | [6-methoxy-7-methyl-5-[(E)-3-methyl-6-oxohept-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 5-butanoyloxy-2-methylpentanoate |
|---|---|
| PubChem CID | 142611288 |
| Molecular Formula | C28H38O8 |
| Molecular Weight | 502.60 g/mol |
| Exact Mass | 502.26 |
| IUPAC Name | [6-methoxy-7-methyl-5-[(E)-3-methyl-6-oxohept-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 5-butanoyloxy-2-methylpentanoate |
| SMILES | CCCC(=O)OCCCC(C)C(=O)Oc1c(C/C=C(\C)CCC(C)=O)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C28H38O8/c1-7-9-23(30)34-15-8-10-18(3)27(31)36-26-21(14-12-17(2)11-13-19(4)29)25(33-6)20(5)22-16-35-28(32)24(22)26/h12,18H,7-11,13-16H2,1-6H3/b17-12+ |
| InChIKey | YSXVPPJMRDJCBN-SFQUDFHCSA-N |
| XLogP | 5.20 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|