C27H35NO10 — CID 54003499
1-O-ethyl 2-O-[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] oxalate (PubChem CID 54003499) has the molecular formula C27H35NO10 and a molecular weight of 533.57 g/mol. Its IUPAC name is 1-O-ethyl 2-O-[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] oxalate.
| Compound Name | 1-O-ethyl 2-O-[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] oxalate |
|---|---|
| PubChem CID | 54003499 |
| Molecular Formula | C27H35NO10 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 1-O-ethyl 2-O-[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] oxalate |
| SMILES | CCOC(=O)C(=O)Oc1c(CC=C(C)CCC(=O)OCCN2CCOCC2)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C27H35NO10/c1-5-35-26(31)27(32)38-24-19(23(33-4)18(3)20-16-37-25(30)22(20)24)8-6-17(2)7-9-21(29)36-15-12-28-10-13-34-14-11-28/h6H,5,7-16H2,1-4H3 |
| InChIKey | KNGJRHLGCWQWMB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|