C27H35NO10 — CID 66923605
3-O-[6-methoxy-7-methyl-5-[(E)-3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 1-O-methyl propanedioate (PubChem CID 66923605) has the molecular formula C27H35NO10 and a molecular weight of 533.57 g/mol. Its IUPAC name is 3-O-[6-methoxy-7-methyl-5-[(E)-3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 1-O-methyl propanedioate.
| Compound Name | 3-O-[6-methoxy-7-methyl-5-[(E)-3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 1-O-methyl propanedioate |
|---|---|
| PubChem CID | 66923605 |
| Molecular Formula | C27H35NO10 |
| Molecular Weight | 533.57 g/mol |
| Exact Mass | 533.23 |
| IUPAC Name | 3-O-[6-methoxy-7-methyl-5-[(E)-3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl] 1-O-methyl propanedioate |
| SMILES | COC(=O)CC(=O)Oc1c(C/C=C(\C)CCC(=O)OCCN2CCOCC2)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C27H35NO10/c1-17(6-8-21(29)36-14-11-28-9-12-35-13-10-28)5-7-19-25(34-4)18(2)20-16-37-27(32)24(20)26(19)38-23(31)15-22(30)33-3/h5H,6-16H2,1-4H3/b17-5+ |
| InChIKey | FTPXDATVMYQWBA-YAXRCOADSA-N |
| XLogP | 2.29 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.57 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|