C29H41NO7 — CID 66923812
2-piperidin-1-ylethyl (E)-6-[4-(2,2-dimethylpropanoyloxy)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 66923812) has the molecular formula C29H41NO7 and a molecular weight of 515.65 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl (E)-6-[4-(2,2-dimethylpropanoyloxy)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 2-piperidin-1-ylethyl (E)-6-[4-(2,2-dimethylpropanoyloxy)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 66923812 |
| Molecular Formula | C29H41NO7 |
| Molecular Weight | 515.65 g/mol |
| Exact Mass | 515.29 |
| IUPAC Name | 2-piperidin-1-ylethyl (E)-6-[4-(2,2-dimethylpropanoyloxy)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(OC(=O)C(C)(C)C)c1C/C=C(\C)CCC(=O)OCCN1CCCCC1)C(=O)OC2 |
| InChI | InChI=1S/C29H41NO7/c1-19(11-13-23(31)35-17-16-30-14-8-7-9-15-30)10-12-21-25(34-6)20(2)22-18-36-27(32)24(22)26(21)37-28(33)29(3,4)5/h10H,7-9,11-18H2,1-6H3/b19-10+ |
| InChIKey | HCRSFOKBNPOKQM-VXLYETTFSA-N |
| XLogP | 4.92 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.65 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|