C33H40N2O9S — CID 54348566
ethyl 4-[[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl]oxycarbothioylamino]benzoate (PubChem CID 54348566) has the molecular formula C33H40N2O9S and a molecular weight of 640.76 g/mol. Its IUPAC name is ethyl 4-[[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl]oxycarbothioylamino]benzoate.
| Compound Name | ethyl 4-[[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl]oxycarbothioylamino]benzoate |
|---|---|
| PubChem CID | 54348566 |
| Molecular Formula | C33H40N2O9S |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | ethyl 4-[[6-methoxy-7-methyl-5-[3-methyl-6-(2-morpholin-4-ylethoxy)-6-oxohex-2-enyl]-3-oxo-1H-2-benzofuran-4-yl]oxycarbothioylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=S)Oc2c(CC=C(C)CCC(=O)OCCN3CCOCC3)c(OC)c(C)c3c2C(=O)OC3)cc1 |
| InChI | InChI=1S/C33H40N2O9S/c1-5-41-31(37)23-8-10-24(11-9-23)34-33(45)44-30-25(29(39-4)22(3)26-20-43-32(38)28(26)30)12-6-21(2)7-13-27(36)42-19-16-35-14-17-40-18-15-35/h6,8-11H,5,7,12-20H2,1-4H3,(H,34,45) |
| InChIKey | UEAUUEPXNZHXHD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|