C27H39N3O7 — CID 140503918
4-morpholin-4-ylbutyl (E)-6-[6-methoxy-7-methyl-4-(methylcarbamoylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 140503918) has the molecular formula C27H39N3O7 and a molecular weight of 517.62 g/mol. Its IUPAC name is 4-morpholin-4-ylbutyl (E)-6-[6-methoxy-7-methyl-4-(methylcarbamoylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 4-morpholin-4-ylbutyl (E)-6-[6-methoxy-7-methyl-4-(methylcarbamoylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 140503918 |
| Molecular Formula | C27H39N3O7 |
| Molecular Weight | 517.62 g/mol |
| Exact Mass | 517.28 |
| IUPAC Name | 4-morpholin-4-ylbutyl (E)-6-[6-methoxy-7-methyl-4-(methylcarbamoylamino)-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CNC(=O)Nc1c(C/C=C(\C)CCC(=O)OCCCCN2CCOCC2)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C27H39N3O7/c1-18(8-10-22(31)36-14-6-5-11-30-12-15-35-16-13-30)7-9-20-24(29-27(33)28-3)23-21(17-37-26(23)32)19(2)25(20)34-4/h7H,5-6,8-17H2,1-4H3,(H2,28,29,33)/b18-7+ |
| InChIKey | AOGLWUDFHYJOMJ-CNHKJKLMSA-N |
| XLogP | 3.35 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.62 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|