C32H49N3O7 — CID 67754741
3-morpholin-4-ylpropyl 6-[4-(heptan-3-ylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67754741) has the molecular formula C32H49N3O7 and a molecular weight of 587.76 g/mol. Its IUPAC name is 3-morpholin-4-ylpropyl 6-[4-(heptan-3-ylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 3-morpholin-4-ylpropyl 6-[4-(heptan-3-ylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67754741 |
| Molecular Formula | C32H49N3O7 |
| Molecular Weight | 587.76 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | 3-morpholin-4-ylpropyl 6-[4-(heptan-3-ylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCCCC(CC)NC(=O)Nc1c(CC=C(C)CCC(=O)OCCCN2CCOCC2)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C32H49N3O7/c1-6-8-10-24(7-2)33-32(38)34-29-25(30(39-5)23(4)26-21-42-31(37)28(26)29)13-11-22(3)12-14-27(36)41-18-9-15-35-16-19-40-20-17-35/h11,24H,6-10,12-21H2,1-5H3,(H2,33,34,38) |
| InChIKey | CFDJEHPCMBUNJV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.76 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|