C24H30Cl3NO6 — CID 54134247
3-methylbutyl 6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 54134247) has the molecular formula C24H30Cl3NO6 and a molecular weight of 534.86 g/mol. Its IUPAC name is 3-methylbutyl 6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | 3-methylbutyl 6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54134247 |
| Molecular Formula | C24H30Cl3NO6 |
| Molecular Weight | 534.86 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | 3-methylbutyl 6-[6-methoxy-7-methyl-3-oxo-4-[(2,2,2-trichloroacetyl)amino]-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(NC(=O)C(Cl)(Cl)Cl)c1CC=C(C)CCC(=O)OCCC(C)C)C(=O)OC2 |
| InChI | InChI=1S/C24H30Cl3NO6/c1-13(2)10-11-33-18(29)9-7-14(3)6-8-16-20(28-23(31)24(25,26)27)19-17(12-34-22(19)30)15(4)21(16)32-5/h6,13H,7-12H2,1-5H3,(H,28,31) |
| InChIKey | NWNVAYGOQBPVEY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.86 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|