C22H26Cl2FNO6 — CID 67046315
propan-2-yl (E)-6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046315) has the molecular formula C22H26Cl2FNO6 and a molecular weight of 490.36 g/mol. Its IUPAC name is propan-2-yl (E)-6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | propan-2-yl (E)-6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046315 |
| Molecular Formula | C22H26Cl2FNO6 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | propan-2-yl (E)-6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(NC(=O)C(F)(Cl)Cl)c1C/C=C(\C)CCC(=O)OC(C)C)C(=O)OC2 |
| InChI | InChI=1S/C22H26Cl2FNO6/c1-11(2)32-16(27)9-7-12(3)6-8-14-18(26-21(29)22(23,24)25)17-15(10-31-20(17)28)13(4)19(14)30-5/h6,11H,7-10H2,1-5H3,(H,26,29)/b12-6+ |
| InChIKey | HARYRCYKIMNURU-WUXMJOGZSA-N |
| XLogP | 4.93 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|