C26H24F5NO6 — CID 54012899
[2-(trifluoromethyl)phenyl] 6-[4-[(2,2-difluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 54012899) has the molecular formula C26H24F5NO6 and a molecular weight of 541.47 g/mol. Its IUPAC name is [2-(trifluoromethyl)phenyl] 6-[4-[(2,2-difluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | [2-(trifluoromethyl)phenyl] 6-[4-[(2,2-difluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54012899 |
| Molecular Formula | C26H24F5NO6 |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [2-(trifluoromethyl)phenyl] 6-[4-[(2,2-difluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(NC(=O)C(F)F)c1CC=C(C)CCC(=O)Oc1ccccc1C(F)(F)F)C(=O)OC2 |
| InChI | InChI=1S/C26H24F5NO6/c1-13(9-11-19(33)38-18-7-5-4-6-17(18)26(29,30)31)8-10-15-21(32-24(34)23(27)28)20-16(12-37-25(20)35)14(2)22(15)36-3/h4-8,23H,9-12H2,1-3H3,(H,32,34) |
| InChIKey | KTPRKQOJVXHHMD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|