C38H37ClN2O8 — CID 67046793
(2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046793) has the molecular formula C38H37ClN2O8 and a molecular weight of 685.17 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046793 |
| Molecular Formula | C38H37ClN2O8 |
| Molecular Weight | 685.17 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1ccc(OC(=O)CC/C(C)=C/Cc2c(NC(=O)N(c3ccccc3)c3ccccc3)c3c(c(C)c2OC)COC3=O)c(Cl)c1OC |
| InChI | InChI=1S/C38H37ClN2O8/c1-23(17-21-31(42)49-29-19-20-30(45-3)36(47-5)33(29)39)16-18-27-34(32-28(22-48-37(32)43)24(2)35(27)46-4)40-38(44)41(25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-16,19-20H,17-18,21-22H2,1-5H3,(H,40,44)/b23-16+ |
| InChIKey | TYDGCSSIINRSHB-XQNSMLJCSA-N |
| XLogP | 8.59 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.17 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|