C28H34ClNO7 — CID 67047293
(2-chloro-3,4-dimethoxyphenyl) (E)-6-[6-methoxy-7-methyl-3-oxo-4-(propan-2-ylamino)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67047293) has the molecular formula C28H34ClNO7 and a molecular weight of 532.03 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl) (E)-6-[6-methoxy-7-methyl-3-oxo-4-(propan-2-ylamino)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[6-methoxy-7-methyl-3-oxo-4-(propan-2-ylamino)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67047293 |
| Molecular Formula | C28H34ClNO7 |
| Molecular Weight | 532.03 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[6-methoxy-7-methyl-3-oxo-4-(propan-2-ylamino)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1ccc(OC(=O)CC/C(C)=C/Cc2c(NC(C)C)c3c(c(C)c2OC)COC3=O)c(Cl)c1OC |
| InChI | InChI=1S/C28H34ClNO7/c1-15(2)30-25-18(26(34-6)17(4)19-14-36-28(32)23(19)25)10-8-16(3)9-13-22(31)37-20-11-12-21(33-5)27(35-7)24(20)29/h8,11-12,15,30H,9-10,13-14H2,1-7H3/b16-8+ |
| InChIKey | JSTLVXFJKOUMGN-LZYBPNLTSA-N |
| XLogP | 6.04 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.03 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|