C28H34N2O6 — CID 67046515
phenyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046515) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is phenyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | phenyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046515 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | phenyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCN(CC)C(=O)Nc1c(C/C=C(\C)CCC(=O)Oc2ccccc2)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C28H34N2O6/c1-6-30(7-2)28(33)29-25-21(26(34-5)19(4)22-17-35-27(32)24(22)25)15-13-18(3)14-16-23(31)36-20-11-9-8-10-12-20/h8-13H,6-7,14-17H2,1-5H3,(H,29,33)/b18-13+ |
| InChIKey | SUUZISLCSGDBGQ-QGOAFFKASA-N |
| XLogP | 5.42 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|