C24H34N2O6 — CID 67046792
ethyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046792) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is ethyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | ethyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046792 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | ethyl (E)-6-[4-(diethylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCOC(=O)CC/C(C)=C/Cc1c(NC(=O)N(CC)CC)c2c(c(C)c1OC)COC2=O |
| InChI | InChI=1S/C24H34N2O6/c1-7-26(8-2)24(29)25-21-17(12-10-15(4)11-13-19(27)31-9-3)22(30-6)16(5)18-14-32-23(28)20(18)21/h10H,7-9,11-14H2,1-6H3,(H,25,29)/b15-10+ |
| InChIKey | XGKKGKPCUQGQIA-XNTDXEJSSA-N |
| XLogP | 4.38 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|