C22H26Cl2FNO6 — CID 54440170
propyl 6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 54440170) has the molecular formula C22H26Cl2FNO6 and a molecular weight of 490.36 g/mol. Its IUPAC name is propyl 6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | propyl 6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54440170 |
| Molecular Formula | C22H26Cl2FNO6 |
| Molecular Weight | 490.36 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | propyl 6-[4-[(2,2-dichloro-2-fluoroacetyl)amino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCCOC(=O)CCC(C)=CCc1c(NC(=O)C(F)(Cl)Cl)c2c(c(C)c1OC)COC2=O |
| InChI | InChI=1S/C22H26Cl2FNO6/c1-5-10-31-16(27)9-7-12(2)6-8-14-18(26-21(29)22(23,24)25)17-15(11-32-20(17)28)13(3)19(14)30-4/h6H,5,7-11H2,1-4H3,(H,26,29) |
| InChIKey | WNNRNVJHCITWFZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|