C34H38N2O6 — CID 54076827
tert-butyl 6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 54076827) has the molecular formula C34H38N2O6 and a molecular weight of 570.69 g/mol. Its IUPAC name is tert-butyl 6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | tert-butyl 6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 54076827 |
| Molecular Formula | C34H38N2O6 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | tert-butyl 6-[4-(diphenylcarbamoylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1c(C)c2c(c(NC(=O)N(c3ccccc3)c3ccccc3)c1CC=C(C)CCC(=O)OC(C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C34H38N2O6/c1-22(18-20-28(37)42-34(3,4)5)17-19-26-30(29-27(21-41-32(29)38)23(2)31(26)40-6)35-33(39)36(24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-17H,18-21H2,1-6H3,(H,35,39) |
| InChIKey | MKHIFTBLBHFJNL-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|