C32H32Cl2N2O8 — CID 77250817
(2-chloro-3,4-dimethoxyphenyl) 6-[4-[(2-chlorophenyl)carbamoylamino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 77250817) has the molecular formula C32H32Cl2N2O8 and a molecular weight of 643.52 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl) 6-[4-[(2-chlorophenyl)carbamoylamino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl) 6-[4-[(2-chlorophenyl)carbamoylamino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 77250817 |
| Molecular Formula | C32H32Cl2N2O8 |
| Molecular Weight | 643.52 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl) 6-[4-[(2-chlorophenyl)carbamoylamino]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | COc1ccc(OC(=O)CCC(C)=CCc2c(NC(=O)Nc3ccccc3Cl)c3c(c(C)c2OC)COC3=O)c(Cl)c1OC |
| InChI | InChI=1S/C32H32Cl2N2O8/c1-17(11-15-25(37)44-23-13-14-24(40-3)30(42-5)27(23)34)10-12-19-28(36-32(39)35-22-9-7-6-8-21(22)33)26-20(16-43-31(26)38)18(2)29(19)41-4/h6-10,13-14H,11-12,15-16H2,1-5H3,(H2,35,36,39) |
| InChIKey | OWRNTCVERDALDF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.52 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|