C27H32ClNO7 — CID 67046769
(2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate (PubChem CID 67046769) has the molecular formula C27H32ClNO7 and a molecular weight of 518.01 g/mol. Its IUPAC name is (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate.
| Compound Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
|---|---|
| PubChem CID | 67046769 |
| Molecular Formula | C27H32ClNO7 |
| Molecular Weight | 518.01 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | (2-chloro-3,4-dimethoxyphenyl) (E)-6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-4-methylhex-4-enoate |
| SMILES | CCNc1c(C/C=C(\C)CCC(=O)Oc2ccc(OC)c(OC)c2Cl)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C27H32ClNO7/c1-7-29-24-17(25(33-5)16(3)18-14-35-27(31)22(18)24)10-8-15(2)9-13-21(30)36-19-11-12-20(32-4)26(34-6)23(19)28/h8,11-12,29H,7,9-10,13-14H2,1-6H3/b15-8+ |
| InChIKey | ZSVWUUSHOWNGBM-OVCLIPMQSA-N |
| XLogP | 5.65 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.01 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|