C20H27NO5 — CID 54097556
6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid (PubChem CID 54097556) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid.
| Compound Name | 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid |
|---|---|
| PubChem CID | 54097556 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 6-[4-(ethylamino)-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid |
| SMILES | CCNc1c(CC=C(C)CC(C)C(=O)O)c(OC)c(C)c2c1C(=O)OC2 |
| InChI | InChI=1S/C20H27NO5/c1-6-21-17-14(8-7-11(2)9-12(3)19(22)23)18(25-5)13(4)15-10-26-20(24)16(15)17/h7,12,21H,6,8-10H2,1-5H3,(H,22,23) |
| InChIKey | MYERJBLQOWQMLG-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|