C24H36O6Si — CID 54253172
6-[4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid (PubChem CID 54253172) has the molecular formula C24H36O6Si and a molecular weight of 448.63 g/mol. Its IUPAC name is 6-[4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid.
| Compound Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid |
|---|---|
| PubChem CID | 54253172 |
| Molecular Formula | C24H36O6Si |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | 6-[4-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl]-2,4-dimethylhex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(O[Si](C)(C)C(C)(C)C)c1CC=C(C)CC(C)C(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C24H36O6Si/c1-14(12-15(2)22(25)26)10-11-17-20(28-7)16(3)18-13-29-23(27)19(18)21(17)30-31(8,9)24(4,5)6/h10,15H,11-13H2,1-9H3,(H,25,26) |
| InChIKey | QYEOHQHKKYFKAK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|