C30H52O6Si2 — CID 131719273
7-[tert-butyl(dimethyl)silyl]oxy-6-(2-hydroxy-3,6,7,8,8-pentamethyl-7-silyloxynon-3-enyl)-5-methoxy-4-methyl-3H-2-benzofuran-1-one (PubChem CID 131719273) has the molecular formula C30H52O6Si2 and a molecular weight of 564.91 g/mol. Its IUPAC name is 7-[tert-butyl(dimethyl)silyl]oxy-6-(2-hydroxy-3,6,7,8,8-pentamethyl-7-silyloxynon-3-enyl)-5-methoxy-4-methyl-3H-2-benzofuran-1-one.
| Compound Name | 7-[tert-butyl(dimethyl)silyl]oxy-6-(2-hydroxy-3,6,7,8,8-pentamethyl-7-silyloxynon-3-enyl)-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 131719273 |
| Molecular Formula | C30H52O6Si2 |
| Molecular Weight | 564.91 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 7-[tert-butyl(dimethyl)silyl]oxy-6-(2-hydroxy-3,6,7,8,8-pentamethyl-7-silyloxynon-3-enyl)-5-methoxy-4-methyl-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(O[Si](C)(C)C(C)(C)C)c1CC(O)C(C)=CCC(C)C(C)(O[SiH3])C(C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C30H52O6Si2/c1-18(14-15-19(2)30(10,36-37)28(4,5)6)23(31)16-21-25(33-11)20(3)22-17-34-27(32)24(22)26(21)35-38(12,13)29(7,8)9/h14,19,23,31H,15-17H2,1-13,37H3 |
| InChIKey | GYMKPDRJNMFMFB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.91 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|