C17H21FO3 — CID 67474919
7-(18F)fluoro-5-methoxy-4-methyl-6-[(E)-3-methylhex-2-enyl]-3H-2-benzofuran-1-one (PubChem CID 67474919) has the molecular formula C17H21FO3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 7-(18F)fluoro-5-methoxy-4-methyl-6-[(E)-3-methylhex-2-enyl]-3H-2-benzofuran-1-one.
| Compound Name | 7-(18F)fluoro-5-methoxy-4-methyl-6-[(E)-3-methylhex-2-enyl]-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 67474919 |
| Molecular Formula | C17H21FO3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 7-(18F)fluoro-5-methoxy-4-methyl-6-[(E)-3-methylhex-2-enyl]-3H-2-benzofuran-1-one |
| SMILES | CCC/C(C)=C/Cc1c([18F])c2c(c(C)c1OC)COC2=O |
| InChI | InChI=1S/C17H21FO3/c1-5-6-10(2)7-8-12-15(18)14-13(9-21-17(14)19)11(3)16(12)20-4/h7H,5-6,8-9H2,1-4H3/b10-7+/i18-1 |
| InChIKey | BJSUWYHUTRXONH-DMNUIKDJSA-N |
| XLogP | 4.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|