C19H22NO8ReRf- — CID 58587664
nitrosooxymethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate;rhenium;rutherfordium (PubChem CID 58587664) has the molecular formula C19H22NO8ReRf- and a molecular weight of 845.59 g/mol. Its IUPAC name is nitrosooxymethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate;rhenium;rutherfordium.
| Compound Name | nitrosooxymethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate;rhenium;rutherfordium |
|---|---|
| PubChem CID | 58587664 |
| Molecular Formula | C19H22NO8ReRf- |
| Molecular Weight | 845.59 g/mol |
| Exact Mass | 846.21 |
| IUPAC Name | nitrosooxymethyl (E)-6-(4,6-dimethoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoate;rhenium;rutherfordium |
| SMILES | COc1c(C)c2c(c(OC)c1C/C=C(\C)CCC(=O)O[CH-]ON=O)C(=O)OC2.[Re].[Rf] |
| InChI | InChI=1S/C19H22NO8.Re.Rf/c1-11(6-8-15(21)27-10-28-20-23)5-7-13-17(24-3)12(2)14-9-26-19(22)16(14)18(13)25-4;;/h5,10H,6-9H2,1-4H3;;/q-1;;/b11-5+;; |
| InChIKey | BBVRYXONMYUWGX-JYENVBOSSA-N |
| XLogP | 3.31 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.59 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|