C18H20O7 — CID 15229923
5-[(E)-5-carboxy-3-methylpent-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-carboxylic acid (PubChem CID 15229923) has the molecular formula C18H20O7 and a molecular weight of 348.35 g/mol. Its IUPAC name is 5-[(E)-5-carboxy-3-methylpent-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-carboxylic acid.
| Compound Name | 5-[(E)-5-carboxy-3-methylpent-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-carboxylic acid |
|---|---|
| PubChem CID | 15229923 |
| Molecular Formula | C18H20O7 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 5-[(E)-5-carboxy-3-methylpent-2-enyl]-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-4-carboxylic acid |
| SMILES | COc1c(C)c2c(c(C(=O)O)c1C/C=C(\C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C18H20O7/c1-9(5-7-13(19)20)4-6-11-14(17(21)22)15-12(8-25-18(15)23)10(2)16(11)24-3/h4H,5-8H2,1-3H3,(H,19,20)(H,21,22)/b9-4+ |
| InChIKey | FRRLEVYOPXDAMD-RUDMXATFSA-N |
| XLogP | 2.73 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|