C22H32O6Si — CID 57459869
(E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid (PubChem CID 57459869) has the molecular formula C22H32O6Si and a molecular weight of 420.58 g/mol. Its IUPAC name is (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid.
| Compound Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
|---|---|
| PubChem CID | 57459869 |
| Molecular Formula | C22H32O6Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-6-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-4-methylhex-4-enoic acid |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CCC(=O)O)C(=O)OC2 |
| InChI | InChI=1S/C22H32O6Si/c1-14(8-10-18(23)24)7-9-16-20(26-3)15(2)17-13-28-22(25)19(17)21(16)27-11-12-29(4,5)6/h7H,8-13H2,1-6H3,(H,23,24)/b14-7+ |
| InChIKey | ZRHNJZLBUBPJLW-VGOFMYFVSA-N |
| XLogP | 4.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|