C22H32O7Si — CID 163708457
6-[(E)-4-(3,3-dihydroxyoxiran-2-yl)-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one (PubChem CID 163708457) has the molecular formula C22H32O7Si and a molecular weight of 436.58 g/mol. Its IUPAC name is 6-[(E)-4-(3,3-dihydroxyoxiran-2-yl)-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one.
| Compound Name | 6-[(E)-4-(3,3-dihydroxyoxiran-2-yl)-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163708457 |
| Molecular Formula | C22H32O7Si |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 6-[(E)-4-(3,3-dihydroxyoxiran-2-yl)-3-methylbut-2-enyl]-5-methoxy-4-methyl-7-(2-trimethylsilylethoxy)-3H-2-benzofuran-1-one |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CC1OC1(O)O)C(=O)OC2 |
| InChI | InChI=1S/C22H32O7Si/c1-13(11-17-22(24,25)29-17)7-8-15-19(26-3)14(2)16-12-28-21(23)18(16)20(15)27-9-10-30(4,5)6/h7,17,24-25H,8-12H2,1-6H3/b13-7+ |
| InChIKey | KHCZTJVENZGJNM-NTUHNPAUSA-N |
| XLogP | 3.31 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|