C27H44NO9PSi — CID 59794522
[(2S)-1-ethoxy-1-oxopropan-2-yl]oxy-[2-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl]phosphinic acid (PubChem CID 59794522) has the molecular formula C27H44NO9PSi and a molecular weight of 585.71 g/mol. Its IUPAC name is [(2S)-1-ethoxy-1-oxopropan-2-yl]oxy-[2-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl]phosphinic acid.
| Compound Name | [(2S)-1-ethoxy-1-oxopropan-2-yl]oxy-[2-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl]phosphinic acid |
|---|---|
| PubChem CID | 59794522 |
| Molecular Formula | C27H44NO9PSi |
| Molecular Weight | 585.71 g/mol |
| Exact Mass | 585.25 |
| IUPAC Name | [(2S)-1-ethoxy-1-oxopropan-2-yl]oxy-[2-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl]phosphinic acid |
| SMILES | CCOC(=O)[C@H](C)OP(=O)(O)CCNC/C(C)=C/Cc1c(OC)c(C)c2c(c1OCC[Si](C)(C)C)C(=O)OC2 |
| InChI | InChI=1S/C27H44NO9PSi/c1-9-34-26(29)20(4)37-38(31,32)14-12-28-16-18(2)10-11-21-24(33-5)19(3)22-17-36-27(30)23(22)25(21)35-13-15-39(6,7)8/h10,20,28H,9,11-17H2,1-8H3,(H,31,32)/b18-10+/t20-/m0/s1 |
| InChIKey | MPFOQBSFYHFPER-CYEGBWLXSA-N |
| XLogP | 4.62 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.71 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|