C34H51N2O7PSi — CID 71210659
ethyl (2S)-2-[[2-[[(E)-4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl-phenoxyphosphoryl]amino]propanoate (PubChem CID 71210659) has the molecular formula C34H51N2O7PSi and a molecular weight of 658.85 g/mol. Its IUPAC name is ethyl (2S)-2-[[2-[[(E)-4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2S)-2-[[2-[[(E)-4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 71210659 |
| Molecular Formula | C34H51N2O7PSi |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.32 |
| IUPAC Name | ethyl (2S)-2-[[2-[[(E)-4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]ethyl-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@H](C)NP(=O)(CCNC/C(C)=C/Cc1c(CC)c(C)c2c(c1OCC[Si](C)(C)C)C(=O)OC2)Oc1ccccc1 |
| InChI | InChI=1S/C34H51N2O7PSi/c1-9-28-25(4)30-23-42-34(38)31(30)32(41-19-21-45(6,7)8)29(28)17-16-24(3)22-35-18-20-44(39,36-26(5)33(37)40-10-2)43-27-14-12-11-13-15-27/h11-16,26,35H,9-10,17-23H2,1-8H3,(H,36,39)/b24-16+/t26-,44?/m0/s1 |
| InChIKey | IHRSRPZJIOHENS-IJNOIIBXSA-N |
| XLogP | 6.84 |
| TPSA | 112.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|