C21H34O3PSi+ — CID 163917628
[4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]phosphanium (PubChem CID 163917628) has the molecular formula C21H34O3PSi+ and a molecular weight of 393.56 g/mol. Its IUPAC name is [4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]phosphanium.
| Compound Name | [4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]phosphanium |
|---|---|
| PubChem CID | 163917628 |
| Molecular Formula | C21H34O3PSi+ |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | [4-[6-ethyl-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]phosphanium |
| SMILES | CCc1c(C)c2c(c(OCC[Si](C)(C)C)c1CC=C(C)C[PH3+])C(=O)OC2 |
| InChI | InChI=1S/C21H33O3PSi/c1-7-16-15(3)18-12-24-21(22)19(18)20(23-10-11-26(4,5)6)17(16)9-8-14(2)13-25/h8H,7,9-13,25H2,1-6H3/p+1 |
| InChIKey | QXQFSCCYQSQEEW-UHFFFAOYSA-O |
| XLogP | 5.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|