C24H37NO5Si — CID 142962638
4-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]butanal (PubChem CID 142962638) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is 4-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]butanal.
| Compound Name | 4-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]butanal |
|---|---|
| PubChem CID | 142962638 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 4-[[(E)-4-[6-methoxy-7-methyl-3-oxo-4-(2-trimethylsilylethoxy)-1H-2-benzofuran-5-yl]-2-methylbut-2-enyl]amino]butanal |
| SMILES | COc1c(C)c2c(c(OCC[Si](C)(C)C)c1C/C=C(\C)CNCCCC=O)C(=O)OC2 |
| InChI | InChI=1S/C24H37NO5Si/c1-17(15-25-11-7-8-12-26)9-10-19-22(28-3)18(2)20-16-30-24(27)21(20)23(19)29-13-14-31(4,5)6/h9,12,25H,7-8,10-11,13-16H2,1-6H3/b17-9+ |
| InChIKey | HWBCZVHXRGRBHU-RQZCQDPDSA-N |
| XLogP | 4.45 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|